C21H18BrFN4O2 — CID 123677677
(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-[2-fluoro-6-[(4-methoxyphenyl)methylamino]-3-pyridinyl]methanol (PubChem CID 123677677) has the molecular formula C21H18BrFN4O2 and a molecular weight of 457.30 g/mol. Its IUPAC name is (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-[2-fluoro-6-[(4-methoxyphenyl)methylamino]-3-pyridinyl]methanol.
| Compound Name | (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-[2-fluoro-6-[(4-methoxyphenyl)methylamino]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 123677677 |
| Molecular Formula | C21H18BrFN4O2 |
| Molecular Weight | 457.30 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | (5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-[2-fluoro-6-[(4-methoxyphenyl)methylamino]-3-pyridinyl]methanol |
| SMILES | COc1ccc(CNc2ccc(C(O)c3c[nH]c4ncc(Br)cc34)c(F)n2)cc1 |
| InChI | InChI=1S/C21H18BrFN4O2/c1-29-14-4-2-12(3-5-14)9-24-18-7-6-15(20(23)27-18)19(28)17-11-26-21-16(17)8-13(22)10-25-21/h2-8,10-11,19,28H,9H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | BTUSPRDTDWQDMI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|