C16H14BrN3O — CID 164934777
3-bromo-N-[(4-methoxyphenyl)methyl]-1,6-naphthyridin-7-amine (PubChem CID 164934777) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-bromo-N-[(4-methoxyphenyl)methyl]-1,6-naphthyridin-7-amine.
| Compound Name | 3-bromo-N-[(4-methoxyphenyl)methyl]-1,6-naphthyridin-7-amine |
|---|---|
| PubChem CID | 164934777 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-bromo-N-[(4-methoxyphenyl)methyl]-1,6-naphthyridin-7-amine |
| SMILES | COc1ccc(CNc2cc3ncc(Br)cc3cn2)cc1 |
| InChI | InChI=1S/C16H14BrN3O/c1-21-14-4-2-11(3-5-14)8-19-16-7-15-12(9-20-16)6-13(17)10-18-15/h2-7,9-10H,8H2,1H3,(H,19,20) |
| InChIKey | VOFPPAIMFSAIFU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |