C14H11BrFN3O — CID 68668956
(3-amino-2-fluorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol (PubChem CID 68668956) has the molecular formula C14H11BrFN3O and a molecular weight of 336.16 g/mol. Its IUPAC name is (3-amino-2-fluorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol.
| Compound Name | (3-amino-2-fluorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 68668956 |
| Molecular Formula | C14H11BrFN3O |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | (3-amino-2-fluorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanol |
| SMILES | Nc1cccc(C(O)c2c[nH]c3ncc(Br)cc23)c1F |
| InChI | InChI=1S/C14H11BrFN3O/c15-7-4-9-10(6-19-14(9)18-5-7)13(20)8-2-1-3-11(17)12(8)16/h1-6,13,20H,17H2,(H,18,19) |
| InChIKey | OZNKMIQFRZJIAN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|