About 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline
3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline (PubChem CID 146501921) has the molecular formula C13H8BrF2N3O
and a molecular weight of 340.13 g/mol. Its IUPAC name is 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline.
Molecular Properties
| Compound Name | 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline |
| PubChem CID | 146501921 |
| Molecular Formula | C13H8BrF2N3O |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline |
| SMILES | Nc1ccc(F)c(Oc2c[nH]c3ncc(Br)cc23)c1F |
| InChI | InChI=1S/C13H8BrF2N3O/c14-6-3-7-10(5-19-13(7)18-4-6)20-12-8(15)1-2-9(17)11(12)16/h1-5H,17H2,(H,18,19) |
| InChIKey | UZWJEXIXCBLRNU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline?
The IUPAC name of 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline (CID 146501921) is 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline.
What is the SMILES notation for 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline?
The canonical SMILES for 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline is Nc1ccc(F)c(Oc2c[nH]c3ncc(Br)cc23)c1F.
What is the InChIKey of 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline?
The InChIKey is UZWJEXIXCBLRNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrF2N3O/c14-6-3-7-10(5-19-13(7)18-4-6)20-12-8(15)1-2-9(17)11(12)16/h1-5H,17H2,(H,18,19).
What are the key properties of 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline?
3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline has a molecular weight of 340.13 g/mol, XLogP of 3.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)oxy]-2,4-difluoroaniline is sourced from PubChem (CID 146501921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).