C18H20BrFN2O — CID 144735481
5-bromo-3-(3-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridine;ethane;ethene (PubChem CID 144735481) has the molecular formula C18H20BrFN2O and a molecular weight of 379.27 g/mol. Its IUPAC name is 5-bromo-3-(3-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridine;ethane;ethene.
| Compound Name | 5-bromo-3-(3-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridine;ethane;ethene |
|---|---|
| PubChem CID | 144735481 |
| Molecular Formula | C18H20BrFN2O |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 5-bromo-3-(3-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridine;ethane;ethene |
| SMILES | C=C.CC.COc1c(F)cccc1-c1c[nH]c2ncc(Br)cc12 |
| InChI | InChI=1S/C14H10BrFN2O.C2H6.C2H4/c1-19-13-9(3-2-4-12(13)16)11-7-18-14-10(11)5-8(15)6-17-14;2*1-2/h2-7H,1H3,(H,17,18);1-2H3;1-2H2 |
| InChIKey | QYRWWPVKPBNDMB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|