C18H22O5S — CID 129384796
[(2R)-2,3-bis(4-methoxyphenyl)propyl] methanesulfonate (PubChem CID 129384796) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is [(2R)-2,3-bis(4-methoxyphenyl)propyl] methanesulfonate.
| Compound Name | [(2R)-2,3-bis(4-methoxyphenyl)propyl] methanesulfonate |
|---|---|
| PubChem CID | 129384796 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [(2R)-2,3-bis(4-methoxyphenyl)propyl] methanesulfonate |
| SMILES | COc1ccc(C[C@@H](COS(C)(=O)=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H22O5S/c1-21-17-8-4-14(5-9-17)12-16(13-23-24(3,19)20)15-6-10-18(22-2)11-7-15/h4-11,16H,12-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | GDMDQIJKDRRPMD-INIZCTEOSA-N |
| XLogP | 3.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|