C18H20Cl2O4S — CID 125466027
[(2S)-2-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)butyl] methanesulfonate (PubChem CID 125466027) has the molecular formula C18H20Cl2O4S and a molecular weight of 403.33 g/mol. Its IUPAC name is [(2S)-2-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)butyl] methanesulfonate.
| Compound Name | [(2S)-2-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)butyl] methanesulfonate |
|---|---|
| PubChem CID | 125466027 |
| Molecular Formula | C18H20Cl2O4S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [(2S)-2-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)butyl] methanesulfonate |
| SMILES | COc1ccc(CC[C@H](COS(C)(=O)=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H20Cl2O4S/c1-23-16-8-4-13(5-9-16)3-6-14(12-24-25(2,21)22)17-10-7-15(19)11-18(17)20/h4-5,7-11,14H,3,6,12H2,1-2H3/t14-/m1/s1 |
| InChIKey | KMBQTJGMRZBQHT-CQSZACIVSA-N |
| XLogP | 4.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|