C16H15Cl3O3S — CID 21499495
[2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)propyl] methanesulfonate (PubChem CID 21499495) has the molecular formula C16H15Cl3O3S and a molecular weight of 393.72 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)propyl] methanesulfonate.
| Compound Name | [2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)propyl] methanesulfonate |
|---|---|
| PubChem CID | 21499495 |
| Molecular Formula | C16H15Cl3O3S |
| Molecular Weight | 393.72 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | [2-(4-chlorophenyl)-3-(2,4-dichlorophenyl)propyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC(Cc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl3O3S/c1-23(20,21)22-10-13(11-2-5-14(17)6-3-11)8-12-4-7-15(18)9-16(12)19/h2-7,9,13H,8,10H2,1H3 |
| InChIKey | CZILXXSYQPFBDG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.72 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|