C16H14Cl4O3S — CID 129384562
[(2R)-2-(2,4-dichlorophenyl)-3-(2,6-dichlorophenyl)propyl] methanesulfonate (PubChem CID 129384562) has the molecular formula C16H14Cl4O3S and a molecular weight of 428.16 g/mol. Its IUPAC name is [(2R)-2-(2,4-dichlorophenyl)-3-(2,6-dichlorophenyl)propyl] methanesulfonate.
| Compound Name | [(2R)-2-(2,4-dichlorophenyl)-3-(2,6-dichlorophenyl)propyl] methanesulfonate |
|---|---|
| PubChem CID | 129384562 |
| Molecular Formula | C16H14Cl4O3S |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 425.94 |
| IUPAC Name | [(2R)-2-(2,4-dichlorophenyl)-3-(2,6-dichlorophenyl)propyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H](Cc1c(Cl)cccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl4O3S/c1-24(21,22)23-9-10(12-6-5-11(17)8-16(12)20)7-13-14(18)3-2-4-15(13)19/h2-6,8,10H,7,9H2,1H3/t10-/m0/s1 |
| InChIKey | NZFRFGBKMLUWCU-JTQLQIEISA-N |
| XLogP | 5.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.16 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|