C8H7Cl3O3S — CID 139714395
(2,3,6-trichlorophenyl)methyl methanesulfonate (PubChem CID 139714395) has the molecular formula C8H7Cl3O3S and a molecular weight of 289.57 g/mol. Its IUPAC name is (2,3,6-trichlorophenyl)methyl methanesulfonate.
| Compound Name | (2,3,6-trichlorophenyl)methyl methanesulfonate |
|---|---|
| PubChem CID | 139714395 |
| Molecular Formula | C8H7Cl3O3S |
| Molecular Weight | 289.57 g/mol |
| Exact Mass | 287.92 |
| IUPAC Name | (2,3,6-trichlorophenyl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C8H7Cl3O3S/c1-15(12,13)14-4-5-6(9)2-3-7(10)8(5)11/h2-3H,4H2,1H3 |
| InChIKey | BMRLTGMXWRSGMF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|