C10H8Cl2O4S — CID 118564134
(5,7-dichloro-1-benzofuran-3-yl)methyl methanesulfonate (PubChem CID 118564134) has the molecular formula C10H8Cl2O4S and a molecular weight of 295.14 g/mol. Its IUPAC name is (5,7-dichloro-1-benzofuran-3-yl)methyl methanesulfonate.
| Compound Name | (5,7-dichloro-1-benzofuran-3-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 118564134 |
| Molecular Formula | C10H8Cl2O4S |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | (5,7-dichloro-1-benzofuran-3-yl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1coc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C10H8Cl2O4S/c1-17(13,14)16-5-6-4-15-10-8(6)2-7(11)3-9(10)12/h2-4H,5H2,1H3 |
| InChIKey | VVJVFZFVNMXKOX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|