C15H24O10S3 — CID 98531443
[(3S)-3-[2-(4-methoxyphenoxy)ethylsulfonyl]-4-methylsulfonyloxybutyl] methanesulfonate (PubChem CID 98531443) has the molecular formula C15H24O10S3 and a molecular weight of 460.55 g/mol. Its IUPAC name is [(3S)-3-[2-(4-methoxyphenoxy)ethylsulfonyl]-4-methylsulfonyloxybutyl] methanesulfonate.
| Compound Name | [(3S)-3-[2-(4-methoxyphenoxy)ethylsulfonyl]-4-methylsulfonyloxybutyl] methanesulfonate |
|---|---|
| PubChem CID | 98531443 |
| Molecular Formula | C15H24O10S3 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | [(3S)-3-[2-(4-methoxyphenoxy)ethylsulfonyl]-4-methylsulfonyloxybutyl] methanesulfonate |
| SMILES | COc1ccc(OCCS(=O)(=O)[C@@H](CCOS(C)(=O)=O)COS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24O10S3/c1-22-13-4-6-14(7-5-13)23-10-11-28(20,21)15(12-25-27(3,18)19)8-9-24-26(2,16)17/h4-7,15H,8-12H2,1-3H3/t15-/m0/s1 |
| InChIKey | KVYCFKPRCCKGDX-HNNXBMFYSA-N |
| XLogP | 0.20 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|