C14H24O7S2Si — CID 102131047
2-[(4-methoxyphenyl)-methyl-(2-methylsulfonyloxyethyl)silyl]ethyl methanesulfonate (PubChem CID 102131047) has the molecular formula C14H24O7S2Si and a molecular weight of 396.56 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)-methyl-(2-methylsulfonyloxyethyl)silyl]ethyl methanesulfonate.
| Compound Name | 2-[(4-methoxyphenyl)-methyl-(2-methylsulfonyloxyethyl)silyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 102131047 |
| Molecular Formula | C14H24O7S2Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2-[(4-methoxyphenyl)-methyl-(2-methylsulfonyloxyethyl)silyl]ethyl methanesulfonate |
| SMILES | COc1ccc([Si](C)(CCOS(C)(=O)=O)CCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H24O7S2Si/c1-19-13-5-7-14(8-6-13)24(4,11-9-20-22(2,15)16)12-10-21-23(3,17)18/h5-8H,9-12H2,1-4H3 |
| InChIKey | DQNWTFBKOVWZPV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|