C17H20O2S2 — CID 159169861
1,3-bis(4-methoxyphenyl)propane-1,2-dithiol (PubChem CID 159169861) has the molecular formula C17H20O2S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)propane-1,2-dithiol.
| Compound Name | 1,3-bis(4-methoxyphenyl)propane-1,2-dithiol |
|---|---|
| PubChem CID | 159169861 |
| Molecular Formula | C17H20O2S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)propane-1,2-dithiol |
| SMILES | COc1ccc(CC(S)C(S)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H20O2S2/c1-18-14-7-3-12(4-8-14)11-16(20)17(21)13-5-9-15(19-2)10-6-13/h3-10,16-17,20-21H,11H2,1-2H3 |
| InChIKey | KLNVTIGDFFJEEY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|