C13H17NO2 — CID 11424540
(E)-4-(4-methoxyphenyl)-N,N-dimethylbut-3-enamide (PubChem CID 11424540) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (E)-4-(4-methoxyphenyl)-N,N-dimethylbut-3-enamide.
| Compound Name | (E)-4-(4-methoxyphenyl)-N,N-dimethylbut-3-enamide |
|---|---|
| PubChem CID | 11424540 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (E)-4-(4-methoxyphenyl)-N,N-dimethylbut-3-enamide |
| SMILES | COc1ccc(/C=C/CC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C13H17NO2/c1-14(2)13(15)6-4-5-11-7-9-12(16-3)10-8-11/h4-5,7-10H,6H2,1-3H3/b5-4+ |
| InChIKey | QWUVVSUSDXJWEH-SNAWJCMRSA-N |
| XLogP | 2.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |