C14H15ClF2O — CID 114245614
2-[4-(chloromethyl)-2,6-difluorophenoxy]bicyclo[2.2.1]heptane (PubChem CID 114245614) has the molecular formula C14H15ClF2O and a molecular weight of 272.72 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-2,6-difluorophenoxy]bicyclo[2.2.1]heptane.
| Compound Name | 2-[4-(chloromethyl)-2,6-difluorophenoxy]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 114245614 |
| Molecular Formula | C14H15ClF2O |
| Molecular Weight | 272.72 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[4-(chloromethyl)-2,6-difluorophenoxy]bicyclo[2.2.1]heptane |
| SMILES | Fc1cc(CCl)cc(F)c1OC1CC2CCC1C2 |
| InChI | InChI=1S/C14H15ClF2O/c15-7-9-4-11(16)14(12(17)5-9)18-13-6-8-1-2-10(13)3-8/h4-5,8,10,13H,1-3,6-7H2 |
| InChIKey | VJXHJFJUWWRLMK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|