C16H26ClN — CID 114246234
1-(4-chlorophenyl)-2-methyl-N-propylhexan-1-amine (PubChem CID 114246234) has the molecular formula C16H26ClN and a molecular weight of 267.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-methyl-N-propylhexan-1-amine.
| Compound Name | 1-(4-chlorophenyl)-2-methyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 114246234 |
| Molecular Formula | C16H26ClN |
| Molecular Weight | 267.84 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-(4-chlorophenyl)-2-methyl-N-propylhexan-1-amine |
| SMILES | CCCCC(C)C(NCCC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H26ClN/c1-4-6-7-13(3)16(18-12-5-2)14-8-10-15(17)11-9-14/h8-11,13,16,18H,4-7,12H2,1-3H3 |
| InChIKey | YIOMBGFHFDLPNK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |