[1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid

C11H6N2O2S — CID 11424722

IUPAC[1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid
SMILESO=C(O)c1cccc2cc3cnsc3nc12
InChIInChI=1S/C11H6N2O2S/c14-11(15)8-3-1-2-6-4-7-5-12-16-10(7)13-9(6)8/h1-5H,(H,14,15)
InChIKeyILDGBSVWBZVZQW-UHFFFAOYSA-N
MW230.25 g/mol
LogP2.54
Rot. Bonds1

About [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid

[1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid (PubChem CID 11424722) has the molecular formula C11H6N2O2S and a molecular weight of 230.25 g/mol. Its IUPAC name is [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid.

Molecular Properties

Compound Name[1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid
PubChem CID11424722
Molecular FormulaC11H6N2O2S
Molecular Weight230.25 g/mol
Exact Mass230.01
IUPAC Name[1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid
SMILESO=C(O)c1cccc2cc3cnsc3nc12
InChIInChI=1S/C11H6N2O2S/c14-11(15)8-3-1-2-6-4-7-5-12-16-10(7)13-9(6)8/h1-5H,(H,14,15)
InChIKeyILDGBSVWBZVZQW-UHFFFAOYSA-N
XLogP2.54
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.25
LogP ≤ 52.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid?
The IUPAC name of [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid (CID 11424722) is [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid.
What is the SMILES notation for [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid?
The canonical SMILES for [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid is O=C(O)c1cccc2cc3cnsc3nc12.
What is the InChIKey of [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid?
The InChIKey is ILDGBSVWBZVZQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O2S/c14-11(15)8-3-1-2-6-4-7-5-12-16-10(7)13-9(6)8/h1-5H,(H,14,15).
What are the key properties of [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid?
[1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid has a molecular weight of 230.25 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2]thiazolo[5,4-b]quinoline-8-carboxylic acid is sourced from PubChem (CID 11424722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).