C14H23NO4 — CID 114247494
ethyl 2-[2-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)ethoxy]acetate (PubChem CID 114247494) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl 2-[2-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)ethoxy]acetate.
| Compound Name | ethyl 2-[2-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)ethoxy]acetate |
|---|---|
| PubChem CID | 114247494 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | ethyl 2-[2-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)ethoxy]acetate |
| SMILES | CCOC(=O)COCCN1CC2CC3CC2C1C3O |
| InChI | InChI=1S/C14H23NO4/c1-2-19-12(16)8-18-4-3-15-7-10-5-9-6-11(10)13(15)14(9)17/h9-11,13-14,17H,2-8H2,1H3 |
| InChIKey | BSBCAPLFTGYRNL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|