About 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol
4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol (PubChem CID 114247622) has the molecular formula C13H16BrN3O2
and a molecular weight of 326.19 g/mol. Its IUPAC name is 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol.
Molecular Properties
| Compound Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol |
| PubChem CID | 114247622 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol |
| SMILES | COc1nc(N2CC3CC4CC3C2C4O)ncc1Br |
| InChI | InChI=1S/C13H16BrN3O2/c1-19-12-9(14)4-15-13(16-12)17-5-7-2-6-3-8(7)10(17)11(6)18/h4,6-8,10-11,18H,2-3,5H2,1H3 |
| InChIKey | UUNKTELQWBVLEX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
The IUPAC name of 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol (CID 114247622) is 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol.
What is the SMILES notation for 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
The canonical SMILES for 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol is COc1nc(N2CC3CC4CC3C2C4O)ncc1Br.
What is the InChIKey of 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
The InChIKey is UUNKTELQWBVLEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN3O2/c1-19-12-9(14)4-15-13(16-12)17-5-7-2-6-3-8(7)10(17)11(6)18/h4,6-8,10-11,18H,2-3,5H2,1H3.
What are the key properties of 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol?
4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol has a molecular weight of 326.19 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-4-methoxypyrimidin-2-yl)-4-azatricyclo[4.2.1.03,7]nonan-2-ol is sourced from PubChem (CID 114247622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).