C12H24N4S — CID 114247802
5-N-(3-ethylsulfanylpropyl)-1-methyl-3-propan-2-ylpyrazole-4,5-diamine (PubChem CID 114247802) has the molecular formula C12H24N4S and a molecular weight of 256.42 g/mol. Its IUPAC name is 5-N-(3-ethylsulfanylpropyl)-1-methyl-3-propan-2-ylpyrazole-4,5-diamine.
| Compound Name | 5-N-(3-ethylsulfanylpropyl)-1-methyl-3-propan-2-ylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 114247802 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 5-N-(3-ethylsulfanylpropyl)-1-methyl-3-propan-2-ylpyrazole-4,5-diamine |
| SMILES | CCSCCCNc1c(N)c(C(C)C)nn1C |
| InChI | InChI=1S/C12H24N4S/c1-5-17-8-6-7-14-12-10(13)11(9(2)3)15-16(12)4/h9,14H,5-8,13H2,1-4H3 |
| InChIKey | FKFDOKMXOSFWBX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|