About cycloheptylmethyl 2-(cyclopropylmethylamino)acetate
cycloheptylmethyl 2-(cyclopropylmethylamino)acetate (PubChem CID 114248573) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is cycloheptylmethyl 2-(cyclopropylmethylamino)acetate.
Molecular Properties
| Compound Name | cycloheptylmethyl 2-(cyclopropylmethylamino)acetate |
| PubChem CID | 114248573 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | cycloheptylmethyl 2-(cyclopropylmethylamino)acetate |
| SMILES | O=C(CNCC1CC1)OCC1CCCCCC1 |
| InChI | InChI=1S/C14H25NO2/c16-14(10-15-9-12-7-8-12)17-11-13-5-3-1-2-4-6-13/h12-13,15H,1-11H2 |
| InChIKey | NPVNSHYNDDAKGD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cycloheptylmethyl 2-(cyclopropylmethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptylmethyl 2-(cyclopropylmethylamino)acetate?
The IUPAC name of cycloheptylmethyl 2-(cyclopropylmethylamino)acetate (CID 114248573) is cycloheptylmethyl 2-(cyclopropylmethylamino)acetate.
What is the SMILES notation for cycloheptylmethyl 2-(cyclopropylmethylamino)acetate?
The canonical SMILES for cycloheptylmethyl 2-(cyclopropylmethylamino)acetate is O=C(CNCC1CC1)OCC1CCCCCC1.
What is the InChIKey of cycloheptylmethyl 2-(cyclopropylmethylamino)acetate?
The InChIKey is NPVNSHYNDDAKGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c16-14(10-15-9-12-7-8-12)17-11-13-5-3-1-2-4-6-13/h12-13,15H,1-11H2.
What are the key properties of cycloheptylmethyl 2-(cyclopropylmethylamino)acetate?
cycloheptylmethyl 2-(cyclopropylmethylamino)acetate has a molecular weight of 239.36 g/mol, XLogP of 2.50, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptylmethyl 2-(cyclopropylmethylamino)acetate is sourced from PubChem (CID 114248573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).