About cyclohexylmethyl 3-oxohex-5-enoate
cyclohexylmethyl 3-oxohex-5-enoate (PubChem CID 89082849) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is cyclohexylmethyl 3-oxohex-5-enoate.
Molecular Properties
| Compound Name | cyclohexylmethyl 3-oxohex-5-enoate |
| PubChem CID | 89082849 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | cyclohexylmethyl 3-oxohex-5-enoate |
| SMILES | C=CCC(=O)CC(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C13H20O3/c1-2-6-12(14)9-13(15)16-10-11-7-4-3-5-8-11/h2,11H,1,3-10H2 |
| InChIKey | OQODCXMNXRYRKZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylmethyl 3-oxohex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl 3-oxohex-5-enoate?
The IUPAC name of cyclohexylmethyl 3-oxohex-5-enoate (CID 89082849) is cyclohexylmethyl 3-oxohex-5-enoate.
What is the SMILES notation for cyclohexylmethyl 3-oxohex-5-enoate?
The canonical SMILES for cyclohexylmethyl 3-oxohex-5-enoate is C=CCC(=O)CC(=O)OCC1CCCCC1.
What is the InChIKey of cyclohexylmethyl 3-oxohex-5-enoate?
The InChIKey is OQODCXMNXRYRKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-2-6-12(14)9-13(15)16-10-11-7-4-3-5-8-11/h2,11H,1,3-10H2.
What are the key properties of cyclohexylmethyl 3-oxohex-5-enoate?
cyclohexylmethyl 3-oxohex-5-enoate has a molecular weight of 224.30 g/mol, XLogP of 2.65, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl 3-oxohex-5-enoate is sourced from PubChem (CID 89082849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).