About (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol
(3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol (PubChem CID 114249285) has the molecular formula C15H21BrO2
and a molecular weight of 313.24 g/mol. Its IUPAC name is (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol.
Molecular Properties
| Compound Name | (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol |
| PubChem CID | 114249285 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol |
| SMILES | Cc1cc(C)c(C(O)C2CCC(C)O2)c(C)c1Br |
| InChI | InChI=1S/C15H21BrO2/c1-8-7-9(2)14(16)11(4)13(8)15(17)12-6-5-10(3)18-12/h7,10,12,15,17H,5-6H2,1-4H3 |
| InChIKey | MRMJKXUNXNEBPC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol?
The IUPAC name of (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol (CID 114249285) is (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol.
What is the SMILES notation for (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol?
The canonical SMILES for (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol is Cc1cc(C)c(C(O)C2CCC(C)O2)c(C)c1Br.
What is the InChIKey of (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol?
The InChIKey is MRMJKXUNXNEBPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrO2/c1-8-7-9(2)14(16)11(4)13(8)15(17)12-6-5-10(3)18-12/h7,10,12,15,17H,5-6H2,1-4H3.
What are the key properties of (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol?
(3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol has a molecular weight of 313.24 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-2,4,6-trimethylphenyl)-(5-methyloxolan-2-yl)methanol is sourced from PubChem (CID 114249285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).