C13H19ClO3 — CID 114249646
1-[4-chloro-2-[(1R)-1-hydroxyethyl]phenoxy]-3-methylbutan-2-ol (PubChem CID 114249646) has the molecular formula C13H19ClO3 and a molecular weight of 258.74 g/mol. Its IUPAC name is 1-[4-chloro-2-[(1R)-1-hydroxyethyl]phenoxy]-3-methylbutan-2-ol.
| Compound Name | 1-[4-chloro-2-[(1R)-1-hydroxyethyl]phenoxy]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 114249646 |
| Molecular Formula | C13H19ClO3 |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-[4-chloro-2-[(1R)-1-hydroxyethyl]phenoxy]-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)COc1ccc(Cl)cc1[C@@H](C)O |
| InChI | InChI=1S/C13H19ClO3/c1-8(2)12(16)7-17-13-5-4-10(14)6-11(13)9(3)15/h4-6,8-9,12,15-16H,7H2,1-3H3/t9-,12?/m1/s1 |
| InChIKey | KDJDOQUJYVLBLX-PKEIRNPWSA-N |
| XLogP | 2.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |