C11H18N4O2S — CID 114255059
N-(5-amino-5-sulfanylidenepentyl)-5-methoxy-1-methylpyrazole-3-carboxamide (PubChem CID 114255059) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is N-(5-amino-5-sulfanylidenepentyl)-5-methoxy-1-methylpyrazole-3-carboxamide.
| Compound Name | N-(5-amino-5-sulfanylidenepentyl)-5-methoxy-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 114255059 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(5-amino-5-sulfanylidenepentyl)-5-methoxy-1-methylpyrazole-3-carboxamide |
| SMILES | COc1cc(C(=O)NCCCCC(N)=S)nn1C |
| InChI | InChI=1S/C11H18N4O2S/c1-15-10(17-2)7-8(14-15)11(16)13-6-4-3-5-9(12)18/h7H,3-6H2,1-2H3,(H2,12,18)(H,13,16) |
| InChIKey | AADNYHUFICKZFX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|