C9H14F3N3OS — CID 114255800
N-[(5-methoxy-1-methylpyrazol-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine (PubChem CID 114255800) has the molecular formula C9H14F3N3OS and a molecular weight of 269.29 g/mol. Its IUPAC name is N-[(5-methoxy-1-methylpyrazol-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine.
| Compound Name | N-[(5-methoxy-1-methylpyrazol-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 114255800 |
| Molecular Formula | C9H14F3N3OS |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-[(5-methoxy-1-methylpyrazol-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
| SMILES | COc1cc(CNCCSC(F)(F)F)nn1C |
| InChI | InChI=1S/C9H14F3N3OS/c1-15-8(16-2)5-7(14-15)6-13-3-4-17-9(10,11)12/h5,13H,3-4,6H2,1-2H3 |
| InChIKey | BFMGRJDIEHCQAB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|