C12H13BrFN3O — CID 114255821
N-[(2-bromo-3-fluorophenyl)methyl]-5-methoxy-1-methylpyrazol-3-amine (PubChem CID 114255821) has the molecular formula C12H13BrFN3O and a molecular weight of 314.16 g/mol. Its IUPAC name is N-[(2-bromo-3-fluorophenyl)methyl]-5-methoxy-1-methylpyrazol-3-amine.
| Compound Name | N-[(2-bromo-3-fluorophenyl)methyl]-5-methoxy-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 114255821 |
| Molecular Formula | C12H13BrFN3O |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | N-[(2-bromo-3-fluorophenyl)methyl]-5-methoxy-1-methylpyrazol-3-amine |
| SMILES | COc1cc(NCc2cccc(F)c2Br)nn1C |
| InChI | InChI=1S/C12H13BrFN3O/c1-17-11(18-2)6-10(16-17)15-7-8-4-3-5-9(14)12(8)13/h3-6H,7H2,1-2H3,(H,15,16) |
| InChIKey | MVZSSFYQPCQXJF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |