C13H13BrClN3 — CID 114256281
6-bromo-N-(4-chloro-2-methylphenyl)-2-ethylpyrimidin-4-amine (PubChem CID 114256281) has the molecular formula C13H13BrClN3 and a molecular weight of 326.63 g/mol. Its IUPAC name is 6-bromo-N-(4-chloro-2-methylphenyl)-2-ethylpyrimidin-4-amine.
| Compound Name | 6-bromo-N-(4-chloro-2-methylphenyl)-2-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114256281 |
| Molecular Formula | C13H13BrClN3 |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 6-bromo-N-(4-chloro-2-methylphenyl)-2-ethylpyrimidin-4-amine |
| SMILES | CCc1nc(Br)cc(Nc2ccc(Cl)cc2C)n1 |
| InChI | InChI=1S/C13H13BrClN3/c1-3-12-17-11(14)7-13(18-12)16-10-5-4-9(15)6-8(10)2/h4-7H,3H2,1-2H3,(H,16,17,18) |
| InChIKey | BNZMQESGVZKTNK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |