C18H26ClN3O2 — CID 114256365
tert-butyl 3-[(6-chloro-4-methyl-3-pyridinyl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 114256365) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is tert-butyl 3-[(6-chloro-4-methyl-3-pyridinyl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[(6-chloro-4-methyl-3-pyridinyl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 114256365 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | tert-butyl 3-[(6-chloro-4-methyl-3-pyridinyl)amino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Cc1cc(Cl)ncc1NC1CC2CCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26ClN3O2/c1-11-7-16(19)20-10-15(11)21-12-8-13-5-6-14(9-12)22(13)17(23)24-18(2,3)4/h7,10,12-14,21H,5-6,8-9H2,1-4H3 |
| InChIKey | CKZVBKUHSYJERB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|