C21H30ClN6O2S+ — CID 167474626
tert-butyl 3-[amino-[6-chloro-4-(cyclopropylamino)pyridine-3-carboximidoyl]sulfanylmethylidene]-8-aza-3-azoniabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 167474626) has the molecular formula C21H30ClN6O2S+ and a molecular weight of 466.03 g/mol. Its IUPAC name is tert-butyl 3-[amino-[6-chloro-4-(cyclopropylamino)pyridine-3-carboximidoyl]sulfanylmethylidene]-8-aza-3-azoniabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[amino-[6-chloro-4-(cyclopropylamino)pyridine-3-carboximidoyl]sulfanylmethylidene]-8-aza-3-azoniabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 167474626 |
| Molecular Formula | C21H30ClN6O2S+ |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | tert-butyl 3-[amino-[6-chloro-4-(cyclopropylamino)pyridine-3-carboximidoyl]sulfanylmethylidene]-8-aza-3-azoniabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | [H]/N=C(/SC(N)=[N+]1CC2CCC(C1)N2C(=O)OC(C)(C)C)c1cnc(Cl)cc1NC1CC1 |
| InChI | InChI=1S/C21H29ClN6O2S/c1-21(2,3)30-20(29)28-13-6-7-14(28)11-27(10-13)19(24)31-18(23)15-9-25-17(22)8-16(15)26-12-4-5-12/h8-9,12-14,24H,4-7,10-11H2,1-3H3,(H2,23,25,26)/p+1 |
| InChIKey | PCURKDRGEFIUNU-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|