C13H9BrCl2IN — CID 114259513
4-bromo-N-[(2,5-dichlorophenyl)methyl]-3-iodoaniline (PubChem CID 114259513) has the molecular formula C13H9BrCl2IN and a molecular weight of 456.94 g/mol. Its IUPAC name is 4-bromo-N-[(2,5-dichlorophenyl)methyl]-3-iodoaniline.
| Compound Name | 4-bromo-N-[(2,5-dichlorophenyl)methyl]-3-iodoaniline |
|---|---|
| PubChem CID | 114259513 |
| Molecular Formula | C13H9BrCl2IN |
| Molecular Weight | 456.94 g/mol |
| Exact Mass | 454.83 |
| IUPAC Name | 4-bromo-N-[(2,5-dichlorophenyl)methyl]-3-iodoaniline |
| SMILES | Clc1ccc(Cl)c(CNc2ccc(Br)c(I)c2)c1 |
| InChI | InChI=1S/C13H9BrCl2IN/c14-11-3-2-10(6-13(11)17)18-7-8-5-9(15)1-4-12(8)16/h1-6,18H,7H2 |
| InChIKey | AYIXJBMEXUWEDL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.94 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|