C10H9BrF3IN2O — CID 114259830
2-amino-N-(2-bromo-5-iodophenyl)-3,3,3-trifluoro-2-methylpropanamide (PubChem CID 114259830) has the molecular formula C10H9BrF3IN2O and a molecular weight of 437.00 g/mol. Its IUPAC name is 2-amino-N-(2-bromo-5-iodophenyl)-3,3,3-trifluoro-2-methylpropanamide.
| Compound Name | 2-amino-N-(2-bromo-5-iodophenyl)-3,3,3-trifluoro-2-methylpropanamide |
|---|---|
| PubChem CID | 114259830 |
| Molecular Formula | C10H9BrF3IN2O |
| Molecular Weight | 437.00 g/mol |
| Exact Mass | 435.89 |
| IUPAC Name | 2-amino-N-(2-bromo-5-iodophenyl)-3,3,3-trifluoro-2-methylpropanamide |
| SMILES | CC(N)(C(=O)Nc1cc(I)ccc1Br)C(F)(F)F |
| InChI | InChI=1S/C10H9BrF3IN2O/c1-9(16,10(12,13)14)8(18)17-7-4-5(15)2-3-6(7)11/h2-4H,16H2,1H3,(H,17,18) |
| InChIKey | GKVSQWQYLSPMPE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.00 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|