C12H14BrIN2O — CID 114259911
N-(2-bromo-4-iodophenyl)-2-(cyclopropylmethylamino)acetamide (PubChem CID 114259911) has the molecular formula C12H14BrIN2O and a molecular weight of 409.07 g/mol. Its IUPAC name is N-(2-bromo-4-iodophenyl)-2-(cyclopropylmethylamino)acetamide.
| Compound Name | N-(2-bromo-4-iodophenyl)-2-(cyclopropylmethylamino)acetamide |
|---|---|
| PubChem CID | 114259911 |
| Molecular Formula | C12H14BrIN2O |
| Molecular Weight | 409.07 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | N-(2-bromo-4-iodophenyl)-2-(cyclopropylmethylamino)acetamide |
| SMILES | O=C(CNCC1CC1)Nc1ccc(I)cc1Br |
| InChI | InChI=1S/C12H14BrIN2O/c13-10-5-9(14)3-4-11(10)16-12(17)7-15-6-8-1-2-8/h3-5,8,15H,1-2,6-7H2,(H,16,17) |
| InChIKey | VOKNEZPOAFAFCS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.07 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|