C12H14BrIN2S — CID 114260707
N-(2-bromo-5-iodophenyl)-4,4-dimethyl-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 114260707) has the molecular formula C12H14BrIN2S and a molecular weight of 425.13 g/mol. Its IUPAC name is N-(2-bromo-5-iodophenyl)-4,4-dimethyl-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | N-(2-bromo-5-iodophenyl)-4,4-dimethyl-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 114260707 |
| Molecular Formula | C12H14BrIN2S |
| Molecular Weight | 425.13 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | N-(2-bromo-5-iodophenyl)-4,4-dimethyl-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CC1(C)CCSC(Nc2cc(I)ccc2Br)=N1 |
| InChI | InChI=1S/C12H14BrIN2S/c1-12(2)5-6-17-11(16-12)15-10-7-8(14)3-4-9(10)13/h3-4,7H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | XZSXBEINRXTCNW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.13 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|