C11H11BrF2N2S — CID 102854306
N-(5-bromo-2,4-difluorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine (PubChem CID 102854306) has the molecular formula C11H11BrF2N2S and a molecular weight of 321.19 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102854306 |
| Molecular Formula | C11H11BrF2N2S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
| SMILES | CC1(C)CSC(Nc2cc(Br)c(F)cc2F)=N1 |
| InChI | InChI=1S/C11H11BrF2N2S/c1-11(2)5-17-10(16-11)15-9-3-6(12)7(13)4-8(9)14/h3-4H,5H2,1-2H3,(H,15,16) |
| InChIKey | ZVEJGRJICPRRJO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|