C15H11BrF2N2S — CID 102854291
N-(5-bromo-2,4-difluorophenyl)-4-phenyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 102854291) has the molecular formula C15H11BrF2N2S and a molecular weight of 369.23 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-4-phenyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-4-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102854291 |
| Molecular Formula | C15H11BrF2N2S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-4-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | Fc1cc(F)c(NC2=NC(c3ccccc3)CS2)cc1Br |
| InChI | InChI=1S/C15H11BrF2N2S/c16-10-6-13(12(18)7-11(10)17)19-15-20-14(8-21-15)9-4-2-1-3-5-9/h1-7,14H,8H2,(H,19,20) |
| InChIKey | GGWNSACZNJFDOC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|