C13H15BrF2N2S — CID 102854296
N-(5-bromo-2,4-difluorophenyl)-4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 102854296) has the molecular formula C13H15BrF2N2S and a molecular weight of 349.24 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102854296 |
| Molecular Formula | C13H15BrF2N2S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-4-(2-methylpropyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC(C)CC1CSC(Nc2cc(Br)c(F)cc2F)=N1 |
| InChI | InChI=1S/C13H15BrF2N2S/c1-7(2)3-8-6-19-13(17-8)18-12-4-9(14)10(15)5-11(12)16/h4-5,7-8H,3,6H2,1-2H3,(H,17,18) |
| InChIKey | TVEQSRFIRDPIOP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|