C13H18N2O2S — CID 43382052
N-(2,4-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine (PubChem CID 43382052) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(2,4-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43382052 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
| SMILES | COc1ccc(NC2=NC(C)(C)CS2)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O2S/c1-13(2)8-18-12(15-13)14-10-6-5-9(16-3)7-11(10)17-4/h5-7H,8H2,1-4H3,(H,14,15) |
| InChIKey | GVXSIADIPGVGOA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |