C15H22N2O2S — CID 43439757
N-(2,5-diethoxyphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine (PubChem CID 43439757) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(2,5-diethoxyphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43439757 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(OCC)c(NC2=NC(C)(C)CS2)c1 |
| InChI | InChI=1S/C15H22N2O2S/c1-5-18-11-7-8-13(19-6-2)12(9-11)16-14-17-15(3,4)10-20-14/h7-9H,5-6,10H2,1-4H3,(H,16,17) |
| InChIKey | SKMMSSPCXHMTRO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |