C13H18N2S — CID 616412
N-(2-ethylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine (PubChem CID 616412) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is N-(2-ethylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(2-ethylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 616412 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-(2-ethylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
| SMILES | CCc1ccccc1NC1=NC(C)(C)CS1 |
| InChI | InChI=1S/C13H18N2S/c1-4-10-7-5-6-8-11(10)14-12-15-13(2,3)9-16-12/h5-8H,4,9H2,1-3H3,(H,14,15) |
| InChIKey | YYRSCMUVHLOKJM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |