C17H26N2S — CID 106250477
5,5-diethyl-N-(2-propylphenyl)-4,6-dihydro-1,3-thiazin-2-amine (PubChem CID 106250477) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is 5,5-diethyl-N-(2-propylphenyl)-4,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | 5,5-diethyl-N-(2-propylphenyl)-4,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 106250477 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 5,5-diethyl-N-(2-propylphenyl)-4,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CCCc1ccccc1NC1=NCC(CC)(CC)CS1 |
| InChI | InChI=1S/C17H26N2S/c1-4-9-14-10-7-8-11-15(14)19-16-18-12-17(5-2,6-3)13-20-16/h7-8,10-11H,4-6,9,12-13H2,1-3H3,(H,18,19) |
| InChIKey | AJIUPBMBUSMEFD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |