C15H21N3OS — CID 106249819
4-[(5,5-diethyl-4,6-dihydro-1,3-thiazin-2-yl)amino]benzamide (PubChem CID 106249819) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 4-[(5,5-diethyl-4,6-dihydro-1,3-thiazin-2-yl)amino]benzamide.
| Compound Name | 4-[(5,5-diethyl-4,6-dihydro-1,3-thiazin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 106249819 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-[(5,5-diethyl-4,6-dihydro-1,3-thiazin-2-yl)amino]benzamide |
| SMILES | CCC1(CC)CN=C(Nc2ccc(C(N)=O)cc2)SC1 |
| InChI | InChI=1S/C15H21N3OS/c1-3-15(4-2)9-17-14(20-10-15)18-12-7-5-11(6-8-12)13(16)19/h5-8H,3-4,9-10H2,1-2H3,(H2,16,19)(H,17,18) |
| InChIKey | HMIJPWUPJHYASG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |