C16H24N2OS — CID 106250484
N-(3-ethoxyphenyl)-5,5-diethyl-4,6-dihydro-1,3-thiazin-2-amine (PubChem CID 106250484) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-(3-ethoxyphenyl)-5,5-diethyl-4,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | N-(3-ethoxyphenyl)-5,5-diethyl-4,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 106250484 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(3-ethoxyphenyl)-5,5-diethyl-4,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CCOc1cccc(NC2=NCC(CC)(CC)CS2)c1 |
| InChI | InChI=1S/C16H24N2OS/c1-4-16(5-2)11-17-15(20-12-16)18-13-8-7-9-14(10-13)19-6-3/h7-10H,4-6,11-12H2,1-3H3,(H,17,18) |
| InChIKey | PWQPPELBQKBTOX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |