C13H18N2OS — CID 113492430
N-(3-ethoxyphenyl)-5-ethyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 113492430) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is N-(3-ethoxyphenyl)-5-ethyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(3-ethoxyphenyl)-5-ethyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 113492430 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(3-ethoxyphenyl)-5-ethyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCOc1cccc(NC2=NCC(CC)S2)c1 |
| InChI | InChI=1S/C13H18N2OS/c1-3-12-9-14-13(17-12)15-10-6-5-7-11(8-10)16-4-2/h5-8,12H,3-4,9H2,1-2H3,(H,14,15) |
| InChIKey | XPVIXEXVSMRGDD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |