C18H26N2S — CID 106249760
5,5-diethyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydro-1,3-thiazin-2-amine (PubChem CID 106249760) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is 5,5-diethyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | 5,5-diethyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 106249760 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 5,5-diethyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CCC1(CC)CN=C(Nc2cccc3c2CCCC3)SC1 |
| InChI | InChI=1S/C18H26N2S/c1-3-18(4-2)12-19-17(21-13-18)20-16-11-7-9-14-8-5-6-10-15(14)16/h7,9,11H,3-6,8,10,12-13H2,1-2H3,(H,19,20) |
| InChIKey | JTIJQLBNKMBIIN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |