C13H17N3OS — CID 79245948
4-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 79245948) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 4-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | 4-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 79245948 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-[[(4S)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | CC(C)[C@H]1CSC(Nc2ccc(C(N)=O)cc2)=N1 |
| InChI | InChI=1S/C13H17N3OS/c1-8(2)11-7-18-13(16-11)15-10-5-3-9(4-6-10)12(14)17/h3-6,8,11H,7H2,1-2H3,(H2,14,17)(H,15,16)/t11-/m1/s1 |
| InChIKey | LAKITSAYXXJJAD-LLVKDONJSA-N |
| XLogP | 2.32 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |