C15H22N2S — CID 2496498
N-(4-butylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine (PubChem CID 2496498) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-(4-butylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(4-butylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2496498 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(4-butylphenyl)-4,4-dimethyl-5H-1,3-thiazol-2-amine |
| SMILES | CCCCc1ccc(NC2=NC(C)(C)CS2)cc1 |
| InChI | InChI=1S/C15H22N2S/c1-4-5-6-12-7-9-13(10-8-12)16-14-17-15(2,3)11-18-14/h7-10H,4-6,11H2,1-3H3,(H,16,17) |
| InChIKey | VYWRXJYTLDYHPW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |