C14H20N2S — CID 43440181
N-(4-butylphenyl)-4-methyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 43440181) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is N-(4-butylphenyl)-4-methyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(4-butylphenyl)-4-methyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43440181 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-(4-butylphenyl)-4-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCCCc1ccc(NC2=NC(C)CS2)cc1 |
| InChI | InChI=1S/C14H20N2S/c1-3-4-5-12-6-8-13(9-7-12)16-14-15-11(2)10-17-14/h6-9,11H,3-5,10H2,1-2H3,(H,15,16) |
| InChIKey | LXJPMFVXMJRRID-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |