C15H22N2S — CID 2345416
(4R)-N-(4-butylphenyl)-4-ethyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 2345416) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is (4R)-N-(4-butylphenyl)-4-ethyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | (4R)-N-(4-butylphenyl)-4-ethyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2345416 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (4R)-N-(4-butylphenyl)-4-ethyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCCCc1ccc(NC2=N[C@H](CC)CS2)cc1 |
| InChI | InChI=1S/C15H22N2S/c1-3-5-6-12-7-9-14(10-8-12)17-15-16-13(4-2)11-18-15/h7-10,13H,3-6,11H2,1-2H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | JIDQKIIMNKDRLU-CYBMUJFWSA-N |
| XLogP | 4.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |